C20H12Cl2N4O4 — CID 5341137
(4E)-1-(3,4-dichlorophenyl)-4-[[1-(4-nitrophenyl)pyrrol-2-yl]methylidene]pyrazolidine-3,5-dione (PubChem CID 5341137) has the molecular formula C20H12Cl2N4O4 and a molecular weight of 443.25 g/mol. Its IUPAC name is (4E)-1-(3,4-dichlorophenyl)-4-[[1-(4-nitrophenyl)pyrrol-2-yl]methylidene]pyrazolidine-3,5-dione.
| Compound Name | (4E)-1-(3,4-dichlorophenyl)-4-[[1-(4-nitrophenyl)pyrrol-2-yl]methylidene]pyrazolidine-3,5-dione |
|---|---|
| PubChem CID | 5341137 |
| Molecular Formula | C20H12Cl2N4O4 |
| Molecular Weight | 443.25 g/mol |
| Exact Mass | 442.02 |
| IUPAC Name | (4E)-1-(3,4-dichlorophenyl)-4-[[1-(4-nitrophenyl)pyrrol-2-yl]methylidene]pyrazolidine-3,5-dione |
| SMILES | O=C1NN(c2ccc(Cl)c(Cl)c2)C(=O)/C1=C/c1cccn1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H12Cl2N4O4/c21-17-8-7-15(11-18(17)22)25-20(28)16(19(27)23-25)10-14-2-1-9-24(14)12-3-5-13(6-4-12)26(29)30/h1-11H,(H,23,27)/b16-10+ |
| InChIKey | CIQUSMISRISDEP-MHWRWJLKSA-N |
| XLogP | 4.15 |
| TPSA | 97.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.25 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|