C21H12Cl2N2O4S — CID 1016782
[3-[(Z)-[1-(3,4-dichlorophenyl)-3,5-dioxopyrazolidin-4-ylidene]methyl]phenyl] thiophene-2-carboxylate (PubChem CID 1016782) has the molecular formula C21H12Cl2N2O4S and a molecular weight of 459.31 g/mol. Its IUPAC name is [3-[(Z)-[1-(3,4-dichlorophenyl)-3,5-dioxopyrazolidin-4-ylidene]methyl]phenyl] thiophene-2-carboxylate.
| Compound Name | [3-[(Z)-[1-(3,4-dichlorophenyl)-3,5-dioxopyrazolidin-4-ylidene]methyl]phenyl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 1016782 |
| Molecular Formula | C21H12Cl2N2O4S |
| Molecular Weight | 459.31 g/mol |
| Exact Mass | 457.99 |
| IUPAC Name | [3-[(Z)-[1-(3,4-dichlorophenyl)-3,5-dioxopyrazolidin-4-ylidene]methyl]phenyl] thiophene-2-carboxylate |
| SMILES | O=C1NN(c2ccc(Cl)c(Cl)c2)C(=O)/C1=C\c1cccc(OC(=O)c2cccs2)c1 |
| InChI | InChI=1S/C21H12Cl2N2O4S/c22-16-7-6-13(11-17(16)23)25-20(27)15(19(26)24-25)10-12-3-1-4-14(9-12)29-21(28)18-5-2-8-30-18/h1-11H,(H,24,26)/b15-10- |
| InChIKey | YBNAFIMLXZHNTP-GDNBJRDFSA-N |
| XLogP | 4.74 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.31 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|