C23H18N2O4S — CID 1307366
[4-[[1-(3,4-dimethylphenyl)-3,5-dioxopyrazolidin-4-ylidene]methyl]phenyl] thiophene-2-carboxylate (PubChem CID 1307366) has the molecular formula C23H18N2O4S and a molecular weight of 418.47 g/mol. Its IUPAC name is [4-[[1-(3,4-dimethylphenyl)-3,5-dioxopyrazolidin-4-ylidene]methyl]phenyl] thiophene-2-carboxylate.
| Compound Name | [4-[[1-(3,4-dimethylphenyl)-3,5-dioxopyrazolidin-4-ylidene]methyl]phenyl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 1307366 |
| Molecular Formula | C23H18N2O4S |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | [4-[[1-(3,4-dimethylphenyl)-3,5-dioxopyrazolidin-4-ylidene]methyl]phenyl] thiophene-2-carboxylate |
| SMILES | Cc1ccc(N2NC(=O)C(=Cc3ccc(OC(=O)c4cccs4)cc3)C2=O)cc1C |
| InChI | InChI=1S/C23H18N2O4S/c1-14-5-8-17(12-15(14)2)25-22(27)19(21(26)24-25)13-16-6-9-18(10-7-16)29-23(28)20-4-3-11-30-20/h3-13H,1-2H3,(H,24,26) |
| InChIKey | HWYLXZZIGXZJPY-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|