C23H16N2O5S — CID 2285293
4-[(4Z)-3-methylidene-5-oxo-4-[[3-(thiophene-2-carbonyloxy)phenyl]methylidene]pyrazolidin-1-yl]benzoic acid (PubChem CID 2285293) has the molecular formula C23H16N2O5S and a molecular weight of 432.46 g/mol. Its IUPAC name is 4-[(4Z)-3-methylidene-5-oxo-4-[[3-(thiophene-2-carbonyloxy)phenyl]methylidene]pyrazolidin-1-yl]benzoic acid.
| Compound Name | 4-[(4Z)-3-methylidene-5-oxo-4-[[3-(thiophene-2-carbonyloxy)phenyl]methylidene]pyrazolidin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 2285293 |
| Molecular Formula | C23H16N2O5S |
| Molecular Weight | 432.46 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | 4-[(4Z)-3-methylidene-5-oxo-4-[[3-(thiophene-2-carbonyloxy)phenyl]methylidene]pyrazolidin-1-yl]benzoic acid |
| SMILES | C=c1[nH]n(-c2ccc(C(=O)O)cc2)c(=O)/c1=C\c1cccc(OC(=O)c2cccs2)c1 |
| InChI | InChI=1S/C23H16N2O5S/c1-14-19(21(26)25(24-14)17-9-7-16(8-10-17)22(27)28)13-15-4-2-5-18(12-15)30-23(29)20-6-3-11-31-20/h2-13,24H,1H2,(H,27,28)/b19-13- |
| InChIKey | XNSTWNVASYWCDU-UYRXBGFRSA-N |
| XLogP | 2.38 |
| TPSA | 101.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.46 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|