C21H22NOP — CID 102017280
(1S,3R,3aS,6S)-2,6-dimethyl-1,3-diphenyl-3a,6-dihydro-3H-2,1λ5-benzazaphosphole 1-oxide (PubChem CID 102017280) has the molecular formula C21H22NOP and a molecular weight of 335.39 g/mol. Its IUPAC name is (1S,3R,3aS,6S)-2,6-dimethyl-1,3-diphenyl-3a,6-dihydro-3H-2,1λ5-benzazaphosphole 1-oxide.
| Compound Name | (1S,3R,3aS,6S)-2,6-dimethyl-1,3-diphenyl-3a,6-dihydro-3H-2,1λ5-benzazaphosphole 1-oxide |
|---|---|
| PubChem CID | 102017280 |
| Molecular Formula | C21H22NOP |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | (1S,3R,3aS,6S)-2,6-dimethyl-1,3-diphenyl-3a,6-dihydro-3H-2,1λ5-benzazaphosphole 1-oxide |
| SMILES | C[C@H]1C=C[C@@H]2C(=C1)[P@@](=O)(c1ccccc1)N(C)[C@H]2c1ccccc1 |
| InChI | InChI=1S/C21H22NOP/c1-16-13-14-19-20(15-16)24(23,18-11-7-4-8-12-18)22(2)21(19)17-9-5-3-6-10-17/h3-16,19,21H,1-2H3/t16-,19+,21-,24-/m0/s1 |
| InChIKey | VGEPEGKYCBRXNI-JLDOIHCFSA-N |
| XLogP | 4.98 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|