C22H32N4O4P2 — CID 10743266
N,N'-bis[(2R,4S,5R)-3,4-dimethyl-2-oxo-5-phenyl-1,3,2lambda5-oxazaphospholidin-2-yl]ethane-1,2-diamine (PubChem CID 10743266) has the molecular formula C22H32N4O4P2 and a molecular weight of 478.47 g/mol. Its IUPAC name is N,N'-bis[(2R,4S,5R)-3,4-dimethyl-2-oxo-5-phenyl-1,3,2lambda5-oxazaphospholidin-2-yl]ethane-1,2-diamine.
| Compound Name | N,N'-bis[(2R,4S,5R)-3,4-dimethyl-2-oxo-5-phenyl-1,3,2lambda5-oxazaphospholidin-2-yl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 10743266 |
| Molecular Formula | C22H32N4O4P2 |
| Molecular Weight | 478.47 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | N,N'-bis[(2R,4S,5R)-3,4-dimethyl-2-oxo-5-phenyl-1,3,2lambda5-oxazaphospholidin-2-yl]ethane-1,2-diamine |
| SMILES | C[C@H]1[C@@H](c2ccccc2)O[P@](=O)(NCCN[P@@]2(=O)O[C@H](c3ccccc3)[C@H](C)N2C)N1C |
| InChI | InChI=1S/C22H32N4O4P2/c1-17-21(19-11-7-5-8-12-19)29-31(27,25(17)3)23-15-16-24-32(28)26(4)18(2)22(30-32)20-13-9-6-10-14-20/h5-14,17-18,21-22H,15-16H2,1-4H3,(H,23,27)(H,24,28)/t17-,18-,21-,22-,31+,32+/m0/s1 |
| InChIKey | UOLFPLRRBALVET-UUFLGARFSA-N |
| XLogP | 4.57 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.47 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|