C21H41N2O2PSi2 — CID 23004384
[(1R)-1-[(4S,5R)-3,4-dimethyl-5-phenyl-2-trimethylsilylimino-1,3,2λ5-oxazaphospholidin-2-yl]pentoxy]-trimethylsilane (PubChem CID 23004384) has the molecular formula C21H41N2O2PSi2 and a molecular weight of 440.72 g/mol. Its IUPAC name is [(1R)-1-[(4S,5R)-3,4-dimethyl-5-phenyl-2-trimethylsilylimino-1,3,2λ5-oxazaphospholidin-2-yl]pentoxy]-trimethylsilane.
| Compound Name | [(1R)-1-[(4S,5R)-3,4-dimethyl-5-phenyl-2-trimethylsilylimino-1,3,2λ5-oxazaphospholidin-2-yl]pentoxy]-trimethylsilane |
|---|---|
| PubChem CID | 23004384 |
| Molecular Formula | C21H41N2O2PSi2 |
| Molecular Weight | 440.72 g/mol |
| Exact Mass | 440.24 |
| IUPAC Name | [(1R)-1-[(4S,5R)-3,4-dimethyl-5-phenyl-2-trimethylsilylimino-1,3,2λ5-oxazaphospholidin-2-yl]pentoxy]-trimethylsilane |
| SMILES | CCCC[C@H](O[Si](C)(C)C)P1(=N[Si](C)(C)C)O[C@H](c2ccccc2)[C@H](C)N1C |
| InChI | InChI=1S/C21H41N2O2PSi2/c1-10-11-17-20(25-28(7,8)9)26(22-27(4,5)6)23(3)18(2)21(24-26)19-15-13-12-14-16-19/h12-16,18,20-21H,10-11,17H2,1-9H3/t18-,20+,21-,26?/m0/s1 |
| InChIKey | JTMPRUPSQGCXFI-VAHZHXLASA-N |
| XLogP | 7.31 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.72 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|