C17H20NO2P — CID 10756696
(2S,4S,5R)-2-benzyl-3,4-dimethyl-5-phenyl-1,3,2λ5-oxazaphospholidine 2-oxide (PubChem CID 10756696) has the molecular formula C17H20NO2P and a molecular weight of 301.33 g/mol. Its IUPAC name is (2S,4S,5R)-2-benzyl-3,4-dimethyl-5-phenyl-1,3,2λ5-oxazaphospholidine 2-oxide.
| Compound Name | (2S,4S,5R)-2-benzyl-3,4-dimethyl-5-phenyl-1,3,2λ5-oxazaphospholidine 2-oxide |
|---|---|
| PubChem CID | 10756696 |
| Molecular Formula | C17H20NO2P |
| Molecular Weight | 301.33 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | (2S,4S,5R)-2-benzyl-3,4-dimethyl-5-phenyl-1,3,2λ5-oxazaphospholidine 2-oxide |
| SMILES | C[C@H]1[C@@H](c2ccccc2)O[P@@](=O)(Cc2ccccc2)N1C |
| InChI | InChI=1S/C17H20NO2P/c1-14-17(16-11-7-4-8-12-16)20-21(19,18(14)2)13-15-9-5-3-6-10-15/h3-12,14,17H,13H2,1-2H3/t14-,17-,21-/m0/s1 |
| InChIKey | HSYYOOOMAJSUTR-LFRPXUGBSA-N |
| XLogP | 4.47 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.33 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|