C18H20N2O2 — CID 11120016
(5S,6R)-5-methyl-6-phenyl-4-(2-phenylethyl)-1,3,4-oxadiazinan-2-one (PubChem CID 11120016) has the molecular formula C18H20N2O2 and a molecular weight of 296.37 g/mol. Its IUPAC name is (5S,6R)-5-methyl-6-phenyl-4-(2-phenylethyl)-1,3,4-oxadiazinan-2-one.
| Compound Name | (5S,6R)-5-methyl-6-phenyl-4-(2-phenylethyl)-1,3,4-oxadiazinan-2-one |
|---|---|
| PubChem CID | 11120016 |
| Molecular Formula | C18H20N2O2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | (5S,6R)-5-methyl-6-phenyl-4-(2-phenylethyl)-1,3,4-oxadiazinan-2-one |
| SMILES | C[C@H]1[C@@H](c2ccccc2)OC(=O)NN1CCc1ccccc1 |
| InChI | InChI=1S/C18H20N2O2/c1-14-17(16-10-6-3-7-11-16)22-18(21)19-20(14)13-12-15-8-4-2-5-9-15/h2-11,14,17H,12-13H2,1H3,(H,19,21)/t14-,17-/m0/s1 |
| InChIKey | ABXDRSOTXVTLIK-YOEHRIQHSA-N |
| XLogP | 3.32 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |