C11H14N2OS — CID 11117641
(5S,6R)-4,5-dimethyl-6-phenyl-1,3,4-oxadiazinane-2-thione (PubChem CID 11117641) has the molecular formula C11H14N2OS and a molecular weight of 222.31 g/mol. Its IUPAC name is (5S,6R)-4,5-dimethyl-6-phenyl-1,3,4-oxadiazinane-2-thione.
| Compound Name | (5S,6R)-4,5-dimethyl-6-phenyl-1,3,4-oxadiazinane-2-thione |
|---|---|
| PubChem CID | 11117641 |
| Molecular Formula | C11H14N2OS |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | (5S,6R)-4,5-dimethyl-6-phenyl-1,3,4-oxadiazinane-2-thione |
| SMILES | C[C@H]1[C@@H](c2ccccc2)OC(=S)NN1C |
| InChI | InChI=1S/C11H14N2OS/c1-8-10(9-6-4-3-5-7-9)14-11(15)12-13(8)2/h3-8,10H,1-2H3,(H,12,15)/t8-,10-/m0/s1 |
| InChIKey | VYIKIENZFPUYTQ-WPRPVWTQSA-N |
| XLogP | 1.87 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|