C11H16BNO — CID 599876
2,3,4-trimethyl-5-phenyl-1,3,2-oxazaborolidine (PubChem CID 599876) has the molecular formula C11H16BNO and a molecular weight of 189.07 g/mol. Its IUPAC name is 2,3,4-trimethyl-5-phenyl-1,3,2-oxazaborolidine.
| Compound Name | 2,3,4-trimethyl-5-phenyl-1,3,2-oxazaborolidine |
|---|---|
| PubChem CID | 599876 |
| Molecular Formula | C11H16BNO |
| Molecular Weight | 189.07 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | 2,3,4-trimethyl-5-phenyl-1,3,2-oxazaborolidine |
| SMILES | CB1OC(c2ccccc2)C(C)N1C |
| InChI | InChI=1S/C11H16BNO/c1-9-11(14-12(2)13(9)3)10-7-5-4-6-8-10/h4-9,11H,1-3H3 |
| InChIKey | WFNPVRQGIYWJKV-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.07 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|