C12H18ClNO — CID 50986664
(2S,3S)-3,4-dimethyl-2-phenylmorpholine;hydron;chloride (PubChem CID 50986664) has the molecular formula C12H18ClNO and a molecular weight of 227.74 g/mol. Its IUPAC name is (2S,3S)-3,4-dimethyl-2-phenylmorpholine;hydron;chloride.
| Compound Name | (2S,3S)-3,4-dimethyl-2-phenylmorpholine;hydron;chloride |
|---|---|
| PubChem CID | 50986664 |
| Molecular Formula | C12H18ClNO |
| Molecular Weight | 227.74 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | (2S,3S)-3,4-dimethyl-2-phenylmorpholine;hydron;chloride |
| SMILES | C[C@H]1[C@H](c2ccccc2)OCCN1C.[Cl-].[H+] |
| InChI | InChI=1S/C12H17NO.ClH/c1-10-12(14-9-8-13(10)2)11-6-4-3-5-7-11;/h3-7,10,12H,8-9H2,1-2H3;1H/t10-,12+;/m0./s1 |
| InChIKey | OOQWOQSMHKWCEB-XOZOLZJESA-N |
| XLogP | -0.81 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.74 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |