C22H23NO — CID 118675533
(6S,7R)-4-methyl-6-naphthalen-2-yl-7-phenyl-1,4-oxazepane (PubChem CID 118675533) has the molecular formula C22H23NO and a molecular weight of 317.43 g/mol. Its IUPAC name is (6S,7R)-4-methyl-6-naphthalen-2-yl-7-phenyl-1,4-oxazepane.
| Compound Name | (6S,7R)-4-methyl-6-naphthalen-2-yl-7-phenyl-1,4-oxazepane |
|---|---|
| PubChem CID | 118675533 |
| Molecular Formula | C22H23NO |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | (6S,7R)-4-methyl-6-naphthalen-2-yl-7-phenyl-1,4-oxazepane |
| SMILES | CN1CCO[C@@H](c2ccccc2)[C@@H](c2ccc3ccccc3c2)C1 |
| InChI | InChI=1S/C22H23NO/c1-23-13-14-24-22(18-8-3-2-4-9-18)21(16-23)20-12-11-17-7-5-6-10-19(17)15-20/h2-12,15,21-22H,13-14,16H2,1H3/t21-,22+/m1/s1 |
| InChIKey | ZHTDXMSHUPCRLP-YADHBBJMSA-N |
| XLogP | 4.63 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |