C27H26 — CID 132563382
2-[(1S,2S)-4,4-dimethyl-2-naphthalen-2-ylcyclopentyl]naphthalene (PubChem CID 132563382) has the molecular formula C27H26 and a molecular weight of 350.51 g/mol. Its IUPAC name is 2-[(1S,2S)-4,4-dimethyl-2-naphthalen-2-ylcyclopentyl]naphthalene.
| Compound Name | 2-[(1S,2S)-4,4-dimethyl-2-naphthalen-2-ylcyclopentyl]naphthalene |
|---|---|
| PubChem CID | 132563382 |
| Molecular Formula | C27H26 |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | 2-[(1S,2S)-4,4-dimethyl-2-naphthalen-2-ylcyclopentyl]naphthalene |
| SMILES | CC1(C)C[C@H](c2ccc3ccccc3c2)[C@@H](c2ccc3ccccc3c2)C1 |
| InChI | InChI=1S/C27H26/c1-27(2)17-25(23-13-11-19-7-3-5-9-21(19)15-23)26(18-27)24-14-12-20-8-4-6-10-22(20)16-24/h3-16,25-26H,17-18H2,1-2H3/t25-,26-/m1/s1 |
| InChIKey | KWJVOULOITUTSZ-CLJLJLNGSA-N |
| XLogP | 7.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |