C13H17NO2 — CID 92843868
1-[(2S,3R)-3-methyl-2-phenylmorpholin-4-yl]ethanone (PubChem CID 92843868) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is 1-[(2S,3R)-3-methyl-2-phenylmorpholin-4-yl]ethanone.
| Compound Name | 1-[(2S,3R)-3-methyl-2-phenylmorpholin-4-yl]ethanone |
|---|---|
| PubChem CID | 92843868 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 1-[(2S,3R)-3-methyl-2-phenylmorpholin-4-yl]ethanone |
| SMILES | CC(=O)N1CCO[C@@H](c2ccccc2)[C@H]1C |
| InChI | InChI=1S/C13H17NO2/c1-10-13(12-6-4-3-5-7-12)16-9-8-14(10)11(2)15/h3-7,10,13H,8-9H2,1-2H3/t10-,13-/m1/s1 |
| InChIKey | ZZGGQYMSRNYALW-ZWNOBZJWSA-N |
| XLogP | 1.99 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |