C16H25NO8 — CID 173400053
2,3-dihydroxybutanedioic acid;(2S,3S)-3,4-dimethyl-2-phenylmorpholine;hydrate (PubChem CID 173400053) has the molecular formula C16H25NO8 and a molecular weight of 359.38 g/mol. Its IUPAC name is 2,3-dihydroxybutanedioic acid;(2S,3S)-3,4-dimethyl-2-phenylmorpholine;hydrate.
| Compound Name | 2,3-dihydroxybutanedioic acid;(2S,3S)-3,4-dimethyl-2-phenylmorpholine;hydrate |
|---|---|
| PubChem CID | 173400053 |
| Molecular Formula | C16H25NO8 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | 2,3-dihydroxybutanedioic acid;(2S,3S)-3,4-dimethyl-2-phenylmorpholine;hydrate |
| SMILES | C[C@H]1[C@H](c2ccccc2)OCCN1C.O.O=C(O)C(O)C(O)C(=O)O |
| InChI | InChI=1S/C12H17NO.C4H6O6.H2O/c1-10-12(14-9-8-13(10)2)11-6-4-3-5-7-11;5-1(3(7)8)2(6)4(9)10;/h3-7,10,12H,8-9H2,1-2H3;1-2,5-6H,(H,7,8)(H,9,10);1H2/t10-,12+;;/m0../s1 |
| InChIKey | KJAJOXYZHMIXSL-VWXHXBRYSA-N |
| XLogP | -0.87 |
| TPSA | 159.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |