C13H19NO — CID 68632441
2,2,3,4-tetramethyl-5-phenyl-1,3-oxazolidine (PubChem CID 68632441) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is 2,2,3,4-tetramethyl-5-phenyl-1,3-oxazolidine.
| Compound Name | 2,2,3,4-tetramethyl-5-phenyl-1,3-oxazolidine |
|---|---|
| PubChem CID | 68632441 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | 2,2,3,4-tetramethyl-5-phenyl-1,3-oxazolidine |
| SMILES | CC1C(c2ccccc2)OC(C)(C)N1C |
| InChI | InChI=1S/C13H19NO/c1-10-12(11-8-6-5-7-9-11)15-13(2,3)14(10)4/h5-10,12H,1-4H3 |
| InChIKey | SXPWYSNMKUDXOU-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |