C15H22N2OS — CID 10858834
(5S,6R)-4-(2,2-dimethylpropyl)-5-methyl-6-phenyl-1,3,4-oxadiazinane-2-thione (PubChem CID 10858834) has the molecular formula C15H22N2OS and a molecular weight of 278.42 g/mol. Its IUPAC name is (5S,6R)-4-(2,2-dimethylpropyl)-5-methyl-6-phenyl-1,3,4-oxadiazinane-2-thione.
| Compound Name | (5S,6R)-4-(2,2-dimethylpropyl)-5-methyl-6-phenyl-1,3,4-oxadiazinane-2-thione |
|---|---|
| PubChem CID | 10858834 |
| Molecular Formula | C15H22N2OS |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | (5S,6R)-4-(2,2-dimethylpropyl)-5-methyl-6-phenyl-1,3,4-oxadiazinane-2-thione |
| SMILES | C[C@H]1[C@@H](c2ccccc2)OC(=S)NN1CC(C)(C)C |
| InChI | InChI=1S/C15H22N2OS/c1-11-13(12-8-6-5-7-9-12)18-14(19)16-17(11)10-15(2,3)4/h5-9,11,13H,10H2,1-4H3,(H,16,19)/t11-,13-/m0/s1 |
| InChIKey | AQJOVFQRFKQOQD-AAEUAGOBSA-N |
| XLogP | 3.28 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|