C14H21NO2 — CID 90810932
ethane;5-methyl-3-(2-phenylethyl)-1,3-oxazolidin-2-one (PubChem CID 90810932) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is ethane;5-methyl-3-(2-phenylethyl)-1,3-oxazolidin-2-one.
| Compound Name | ethane;5-methyl-3-(2-phenylethyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 90810932 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | ethane;5-methyl-3-(2-phenylethyl)-1,3-oxazolidin-2-one |
| SMILES | CC.CC1CN(CCc2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C12H15NO2.C2H6/c1-10-9-13(12(14)15-10)8-7-11-5-3-2-4-6-11;1-2/h2-6,10H,7-9H2,1H3;1-2H3 |
| InChIKey | QVBZUMTWWPWPQU-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |