C10H11NO3 — CID 101245141
(4S,5R)-4-(hydroxymethyl)-5-phenyl-1,3-oxazolidin-2-one (PubChem CID 101245141) has the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. Its IUPAC name is (4S,5R)-4-(hydroxymethyl)-5-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4S,5R)-4-(hydroxymethyl)-5-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 101245141 |
| Molecular Formula | C10H11NO3 |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | (4S,5R)-4-(hydroxymethyl)-5-phenyl-1,3-oxazolidin-2-one |
| SMILES | O=C1N[C@@H](CO)[C@@H](c2ccccc2)O1 |
| InChI | InChI=1S/C10H11NO3/c12-6-8-9(14-10(13)11-8)7-4-2-1-3-5-7/h1-5,8-9,12H,6H2,(H,11,13)/t8-,9+/m0/s1 |
| InChIKey | VUTZOFOFUVLOLO-DTWKUNHWSA-N |
| XLogP | 0.83 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |