C11H13NO3 — CID 115062397
4-(hydroxymethyl)-5-(2-methylphenyl)-1,3-oxazolidin-2-one (PubChem CID 115062397) has the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. Its IUPAC name is 4-(hydroxymethyl)-5-(2-methylphenyl)-1,3-oxazolidin-2-one.
| Compound Name | 4-(hydroxymethyl)-5-(2-methylphenyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 115062397 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | 4-(hydroxymethyl)-5-(2-methylphenyl)-1,3-oxazolidin-2-one |
| SMILES | Cc1ccccc1C1OC(=O)NC1CO |
| InChI | InChI=1S/C11H13NO3/c1-7-4-2-3-5-8(7)10-9(6-13)12-11(14)15-10/h2-5,9-10,13H,6H2,1H3,(H,12,14) |
| InChIKey | KOXPOXOMCOLLHR-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |