C19H24O3 — CID 144861754
ethane;[5-(2-methylphenyl)-2-phenyl-1,3-dioxolan-4-yl]methanol (PubChem CID 144861754) has the molecular formula C19H24O3 and a molecular weight of 300.40 g/mol. Its IUPAC name is ethane;[5-(2-methylphenyl)-2-phenyl-1,3-dioxolan-4-yl]methanol.
| Compound Name | ethane;[5-(2-methylphenyl)-2-phenyl-1,3-dioxolan-4-yl]methanol |
|---|---|
| PubChem CID | 144861754 |
| Molecular Formula | C19H24O3 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | ethane;[5-(2-methylphenyl)-2-phenyl-1,3-dioxolan-4-yl]methanol |
| SMILES | CC.Cc1ccccc1C1OC(c2ccccc2)OC1CO |
| InChI | InChI=1S/C17H18O3.C2H6/c1-12-7-5-6-10-14(12)16-15(11-18)19-17(20-16)13-8-3-2-4-9-13;1-2/h2-10,15-18H,11H2,1H3;1-2H3 |
| InChIKey | PGQQHBARPWLFTH-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |