C16H15ClO3 — CID 140688315
[(2S,4S,5S)-5-(2-chlorophenyl)-2-phenyl-1,3-dioxolan-4-yl]methanol (PubChem CID 140688315) has the molecular formula C16H15ClO3 and a molecular weight of 290.75 g/mol. Its IUPAC name is [(2S,4S,5S)-5-(2-chlorophenyl)-2-phenyl-1,3-dioxolan-4-yl]methanol.
| Compound Name | [(2S,4S,5S)-5-(2-chlorophenyl)-2-phenyl-1,3-dioxolan-4-yl]methanol |
|---|---|
| PubChem CID | 140688315 |
| Molecular Formula | C16H15ClO3 |
| Molecular Weight | 290.75 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | [(2S,4S,5S)-5-(2-chlorophenyl)-2-phenyl-1,3-dioxolan-4-yl]methanol |
| SMILES | OC[C@@H]1O[C@@H](c2ccccc2)O[C@H]1c1ccccc1Cl |
| InChI | InChI=1S/C16H15ClO3/c17-13-9-5-4-8-12(13)15-14(10-18)19-16(20-15)11-6-2-1-3-7-11/h1-9,14-16,18H,10H2/t14-,15-,16+/m0/s1 |
| InChIKey | YGVFXSFQDFUWJG-HRCADAONSA-N |
| XLogP | 3.49 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.75 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |