C16H15ClO2 — CID 118140933
(4R,5R)-4-(2-chlorophenyl)-5-methyl-2-phenyl-1,3-dioxolane (PubChem CID 118140933) has the molecular formula C16H15ClO2 and a molecular weight of 274.75 g/mol. Its IUPAC name is (4R,5R)-4-(2-chlorophenyl)-5-methyl-2-phenyl-1,3-dioxolane.
| Compound Name | (4R,5R)-4-(2-chlorophenyl)-5-methyl-2-phenyl-1,3-dioxolane |
|---|---|
| PubChem CID | 118140933 |
| Molecular Formula | C16H15ClO2 |
| Molecular Weight | 274.75 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | (4R,5R)-4-(2-chlorophenyl)-5-methyl-2-phenyl-1,3-dioxolane |
| SMILES | C[C@H]1OC(c2ccccc2)O[C@@H]1c1ccccc1Cl |
| InChI | InChI=1S/C16H15ClO2/c1-11-15(13-9-5-6-10-14(13)17)19-16(18-11)12-7-3-2-4-8-12/h2-11,15-16H,1H3/t11-,15+,16?/m1/s1 |
| InChIKey | YPCFKDDVISSXEV-LKCRCUOOSA-N |
| XLogP | 4.52 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.75 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |