C12H15ClO2 — CID 118141605
(4S,5S)-4-(2-chlorophenyl)-2,2,5-trimethyl-1,3-dioxolane (PubChem CID 118141605) has the molecular formula C12H15ClO2 and a molecular weight of 226.70 g/mol. Its IUPAC name is (4S,5S)-4-(2-chlorophenyl)-2,2,5-trimethyl-1,3-dioxolane.
| Compound Name | (4S,5S)-4-(2-chlorophenyl)-2,2,5-trimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 118141605 |
| Molecular Formula | C12H15ClO2 |
| Molecular Weight | 226.70 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | (4S,5S)-4-(2-chlorophenyl)-2,2,5-trimethyl-1,3-dioxolane |
| SMILES | C[C@@H]1OC(C)(C)O[C@H]1c1ccccc1Cl |
| InChI | InChI=1S/C12H15ClO2/c1-8-11(15-12(2,3)14-8)9-6-4-5-7-10(9)13/h4-8,11H,1-3H3/t8-,11+/m0/s1 |
| InChIKey | ISUKHQTTWKHKPZ-GZMMTYOYSA-N |
| XLogP | 3.55 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.70 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |