C12H14Cl2O2 — CID 144861861
4-(2,6-dichlorophenyl)-2,2,5-trimethyl-1,3-dioxolane (PubChem CID 144861861) has the molecular formula C12H14Cl2O2 and a molecular weight of 261.15 g/mol. Its IUPAC name is 4-(2,6-dichlorophenyl)-2,2,5-trimethyl-1,3-dioxolane.
| Compound Name | 4-(2,6-dichlorophenyl)-2,2,5-trimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 144861861 |
| Molecular Formula | C12H14Cl2O2 |
| Molecular Weight | 261.15 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | 4-(2,6-dichlorophenyl)-2,2,5-trimethyl-1,3-dioxolane |
| SMILES | CC1OC(C)(C)OC1c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C12H14Cl2O2/c1-7-11(16-12(2,3)15-7)10-8(13)5-4-6-9(10)14/h4-7,11H,1-3H3 |
| InChIKey | RBQSNXVHIICOLU-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.15 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |