About 5-chloro-3,3-difluoro-4-methyl-2,4-dihydrochromene;ethane
5-chloro-3,3-difluoro-4-methyl-2,4-dihydrochromene;ethane (PubChem CID 156843570) has the molecular formula C12H15ClF2O
and a molecular weight of 248.70 g/mol. Its IUPAC name is 5-chloro-3,3-difluoro-4-methyl-2,4-dihydrochromene;ethane.
Molecular Properties
| Compound Name | 5-chloro-3,3-difluoro-4-methyl-2,4-dihydrochromene;ethane |
| PubChem CID | 156843570 |
| Molecular Formula | C12H15ClF2O |
| Molecular Weight | 248.70 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 5-chloro-3,3-difluoro-4-methyl-2,4-dihydrochromene;ethane |
| SMILES | CC.CC1c2c(Cl)cccc2OCC1(F)F |
| InChI | InChI=1S/C10H9ClF2O.C2H6/c1-6-9-7(11)3-2-4-8(9)14-5-10(6,12)13;1-2/h2-4,6H,5H2,1H3;1-2H3 |
| InChIKey | LSQSPIIZXRPZRO-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.70 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-chloro-3,3-difluoro-4-methyl-2,4-dihydrochromene;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-3,3-difluoro-4-methyl-2,4-dihydrochromene;ethane?
The IUPAC name of 5-chloro-3,3-difluoro-4-methyl-2,4-dihydrochromene;ethane (CID 156843570) is 5-chloro-3,3-difluoro-4-methyl-2,4-dihydrochromene;ethane.
What is the SMILES notation for 5-chloro-3,3-difluoro-4-methyl-2,4-dihydrochromene;ethane?
The canonical SMILES for 5-chloro-3,3-difluoro-4-methyl-2,4-dihydrochromene;ethane is CC.CC1c2c(Cl)cccc2OCC1(F)F.
What is the InChIKey of 5-chloro-3,3-difluoro-4-methyl-2,4-dihydrochromene;ethane?
The InChIKey is LSQSPIIZXRPZRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9ClF2O.C2H6/c1-6-9-7(11)3-2-4-8(9)14-5-10(6,12)13;1-2/h2-4,6H,5H2,1H3;1-2H3.
What are the key properties of 5-chloro-3,3-difluoro-4-methyl-2,4-dihydrochromene;ethane?
5-chloro-3,3-difluoro-4-methyl-2,4-dihydrochromene;ethane has a molecular weight of 248.70 g/mol, XLogP of 4.50, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-3,3-difluoro-4-methyl-2,4-dihydrochromene;ethane is sourced from PubChem (CID 156843570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).