C12H13ClF2O — CID 166752785
5-chloro-3,3-difluoro-4-propan-2-yl-2,4-dihydrochromene (PubChem CID 166752785) has the molecular formula C12H13ClF2O and a molecular weight of 246.68 g/mol. Its IUPAC name is 5-chloro-3,3-difluoro-4-propan-2-yl-2,4-dihydrochromene.
| Compound Name | 5-chloro-3,3-difluoro-4-propan-2-yl-2,4-dihydrochromene |
|---|---|
| PubChem CID | 166752785 |
| Molecular Formula | C12H13ClF2O |
| Molecular Weight | 246.68 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | 5-chloro-3,3-difluoro-4-propan-2-yl-2,4-dihydrochromene |
| SMILES | CC(C)C1c2c(Cl)cccc2OCC1(F)F |
| InChI | InChI=1S/C12H13ClF2O/c1-7(2)11-10-8(13)4-3-5-9(10)16-6-12(11,14)15/h3-5,7,11H,6H2,1-2H3 |
| InChIKey | HJVKTXDBGBPDPA-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.68 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |