C11H15NO2 — CID 163222163
4-amino-3,3-dimethyl-2,4-dihydrochromen-5-ol (PubChem CID 163222163) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is 4-amino-3,3-dimethyl-2,4-dihydrochromen-5-ol.
| Compound Name | 4-amino-3,3-dimethyl-2,4-dihydrochromen-5-ol |
|---|---|
| PubChem CID | 163222163 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 4-amino-3,3-dimethyl-2,4-dihydrochromen-5-ol |
| SMILES | CC1(C)COc2cccc(O)c2C1N |
| InChI | InChI=1S/C11H15NO2/c1-11(2)6-14-8-5-3-4-7(13)9(8)10(11)12/h3-5,10,13H,6,12H2,1-2H3 |
| InChIKey | ROJLGBNYOBHPSO-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|