About 3-amino-3,4-dihydro-2H-chromen-5-ol
3-amino-3,4-dihydro-2H-chromen-5-ol (PubChem CID 22366572) has the molecular formula C9H11NO2
and a molecular weight of 165.19 g/mol. Its IUPAC name is 3-amino-3,4-dihydro-2H-chromen-5-ol.
Molecular Properties
| Compound Name | 3-amino-3,4-dihydro-2H-chromen-5-ol |
| PubChem CID | 22366572 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | 3-amino-3,4-dihydro-2H-chromen-5-ol |
| SMILES | NC1COc2cccc(O)c2C1 |
| InChI | InChI=1S/C9H11NO2/c10-6-4-7-8(11)2-1-3-9(7)12-5-6/h1-3,6,11H,4-5,10H2 |
| InChIKey | VPUUQIZZTQPFQV-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-amino-3,4-dihydro-2H-chromen-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-3,4-dihydro-2H-chromen-5-ol?
The IUPAC name of 3-amino-3,4-dihydro-2H-chromen-5-ol (CID 22366572) is 3-amino-3,4-dihydro-2H-chromen-5-ol.
What is the SMILES notation for 3-amino-3,4-dihydro-2H-chromen-5-ol?
The canonical SMILES for 3-amino-3,4-dihydro-2H-chromen-5-ol is NC1COc2cccc(O)c2C1.
What is the InChIKey of 3-amino-3,4-dihydro-2H-chromen-5-ol?
The InChIKey is VPUUQIZZTQPFQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2/c10-6-4-7-8(11)2-1-3-9(7)12-5-6/h1-3,6,11H,4-5,10H2.
What are the key properties of 3-amino-3,4-dihydro-2H-chromen-5-ol?
3-amino-3,4-dihydro-2H-chromen-5-ol has a molecular weight of 165.19 g/mol, XLogP of 0.65, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-3,4-dihydro-2H-chromen-5-ol is sourced from PubChem (CID 22366572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).