About 4-hydroxy-2,3-dihydro-1-benzofuran-2-carboxylic acid
4-hydroxy-2,3-dihydro-1-benzofuran-2-carboxylic acid (PubChem CID 14494068) has the molecular formula C9H8O4
and a molecular weight of 180.16 g/mol. Its IUPAC name is 4-hydroxy-2,3-dihydro-1-benzofuran-2-carboxylic acid.
Analyze 4-hydroxy-2,3-dihydro-1-benzofuran-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-2,3-dihydro-1-benzofuran-2-carboxylic acid?
The IUPAC name of 4-hydroxy-2,3-dihydro-1-benzofuran-2-carboxylic acid (CID 14494068) is 4-hydroxy-2,3-dihydro-1-benzofuran-2-carboxylic acid.
What is the SMILES notation for 4-hydroxy-2,3-dihydro-1-benzofuran-2-carboxylic acid?
The canonical SMILES for 4-hydroxy-2,3-dihydro-1-benzofuran-2-carboxylic acid is O=C(O)C1Cc2c(O)cccc2O1.
What is the InChIKey of 4-hydroxy-2,3-dihydro-1-benzofuran-2-carboxylic acid?
The InChIKey is GIONEURRRSIANW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O4/c10-6-2-1-3-7-5(6)4-8(13-7)9(11)12/h1-3,8,10H,4H2,(H,11,12).
What are the key properties of 4-hydroxy-2,3-dihydro-1-benzofuran-2-carboxylic acid?
4-hydroxy-2,3-dihydro-1-benzofuran-2-carboxylic acid has a molecular weight of 180.16 g/mol, XLogP of 0.78, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-2,3-dihydro-1-benzofuran-2-carboxylic acid is sourced from PubChem (CID 14494068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).