C12H14O3 — CID 143772338
(2R,3S)-2-prop-1-en-2-yl-3,4-dihydro-2H-chromene-3,5-diol (PubChem CID 143772338) has the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. Its IUPAC name is (2R,3S)-2-prop-1-en-2-yl-3,4-dihydro-2H-chromene-3,5-diol.
| Compound Name | (2R,3S)-2-prop-1-en-2-yl-3,4-dihydro-2H-chromene-3,5-diol |
|---|---|
| PubChem CID | 143772338 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | (2R,3S)-2-prop-1-en-2-yl-3,4-dihydro-2H-chromene-3,5-diol |
| SMILES | C=C(C)[C@H]1Oc2cccc(O)c2C[C@@H]1O |
| InChI | InChI=1S/C12H14O3/c1-7(2)12-10(14)6-8-9(13)4-3-5-11(8)15-12/h3-5,10,12-14H,1,6H2,2H3/t10-,12+/m0/s1 |
| InChIKey | BVAJFNCEJDGCNS-CMPLNLGQSA-N |
| XLogP | 1.63 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|