C19H16O5 — CID 11163118
5-hydroxy-10-methoxy-2-prop-1-en-2-yl-1,2-dihydrofuro[2,3-c]xanthen-6-one (PubChem CID 11163118) has the molecular formula C19H16O5 and a molecular weight of 324.33 g/mol. Its IUPAC name is 5-hydroxy-10-methoxy-2-prop-1-en-2-yl-1,2-dihydrofuro[2,3-c]xanthen-6-one.
| Compound Name | 5-hydroxy-10-methoxy-2-prop-1-en-2-yl-1,2-dihydrofuro[2,3-c]xanthen-6-one |
|---|---|
| PubChem CID | 11163118 |
| Molecular Formula | C19H16O5 |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | 5-hydroxy-10-methoxy-2-prop-1-en-2-yl-1,2-dihydrofuro[2,3-c]xanthen-6-one |
| SMILES | C=C(C)C1Cc2c(cc(O)c3c(=O)c4cccc(OC)c4oc23)O1 |
| InChI | InChI=1S/C19H16O5/c1-9(2)14-7-11-15(23-14)8-12(20)16-17(21)10-5-4-6-13(22-3)18(10)24-19(11)16/h4-6,8,14,20H,1,7H2,2-3H3 |
| InChIKey | IQIPXSNGVKDTOM-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|