C23H22O7 — CID 163187547
(2R)-7-(4-hydroxy-3-methoxyphenyl)-4,6-dimethoxy-2-prop-1-en-2-yl-2,3-dihydrofuro[3,2-g]chromen-5-one (PubChem CID 163187547) has the molecular formula C23H22O7 and a molecular weight of 410.42 g/mol. Its IUPAC name is (2R)-7-(4-hydroxy-3-methoxyphenyl)-4,6-dimethoxy-2-prop-1-en-2-yl-2,3-dihydrofuro[3,2-g]chromen-5-one.
| Compound Name | (2R)-7-(4-hydroxy-3-methoxyphenyl)-4,6-dimethoxy-2-prop-1-en-2-yl-2,3-dihydrofuro[3,2-g]chromen-5-one |
|---|---|
| PubChem CID | 163187547 |
| Molecular Formula | C23H22O7 |
| Molecular Weight | 410.42 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | (2R)-7-(4-hydroxy-3-methoxyphenyl)-4,6-dimethoxy-2-prop-1-en-2-yl-2,3-dihydrofuro[3,2-g]chromen-5-one |
| SMILES | C=C(C)[C@H]1Cc2c(cc3oc(-c4ccc(O)c(OC)c4)c(OC)c(=O)c3c2OC)O1 |
| InChI | InChI=1S/C23H22O7/c1-11(2)15-9-13-16(29-15)10-18-19(22(13)27-4)20(25)23(28-5)21(30-18)12-6-7-14(24)17(8-12)26-3/h6-8,10,15,24H,1,9H2,2-5H3/t15-/m1/s1 |
| InChIKey | BXRQRJLYPSAKLP-OAHLLOKOSA-N |
| XLogP | 4.07 |
| TPSA | 87.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.42 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|