C17H14O7 — CID 163023602
5,6,7-trihydroxy-2-(4-hydroxy-3-methylphenyl)-3-methoxychromen-4-one (PubChem CID 163023602) has the molecular formula C17H14O7 and a molecular weight of 330.29 g/mol. Its IUPAC name is 5,6,7-trihydroxy-2-(4-hydroxy-3-methylphenyl)-3-methoxychromen-4-one.
| Compound Name | 5,6,7-trihydroxy-2-(4-hydroxy-3-methylphenyl)-3-methoxychromen-4-one |
|---|---|
| PubChem CID | 163023602 |
| Molecular Formula | C17H14O7 |
| Molecular Weight | 330.29 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | 5,6,7-trihydroxy-2-(4-hydroxy-3-methylphenyl)-3-methoxychromen-4-one |
| SMILES | COc1c(-c2ccc(O)c(C)c2)oc2cc(O)c(O)c(O)c2c1=O |
| InChI | InChI=1S/C17H14O7/c1-7-5-8(3-4-9(7)18)16-17(23-2)15(22)12-11(24-16)6-10(19)13(20)14(12)21/h3-6,18-21H,1-2H3 |
| InChIKey | FFWOPSHZQHKRCZ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 120.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.29 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|