C18H14O8 — CID 142903601
4-(5,7-dihydroxy-3,6-dimethoxy-4-oxochromen-2-yl)-2-hydroxybenzaldehyde (PubChem CID 142903601) has the molecular formula C18H14O8 and a molecular weight of 358.30 g/mol. Its IUPAC name is 4-(5,7-dihydroxy-3,6-dimethoxy-4-oxochromen-2-yl)-2-hydroxybenzaldehyde.
| Compound Name | 4-(5,7-dihydroxy-3,6-dimethoxy-4-oxochromen-2-yl)-2-hydroxybenzaldehyde |
|---|---|
| PubChem CID | 142903601 |
| Molecular Formula | C18H14O8 |
| Molecular Weight | 358.30 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | 4-(5,7-dihydroxy-3,6-dimethoxy-4-oxochromen-2-yl)-2-hydroxybenzaldehyde |
| SMILES | COc1c(O)cc2oc(-c3ccc(C=O)c(O)c3)c(OC)c(=O)c2c1O |
| InChI | InChI=1S/C18H14O8/c1-24-17-11(21)6-12-13(14(17)22)15(23)18(25-2)16(26-12)8-3-4-9(7-19)10(20)5-8/h3-7,20-22H,1-2H3 |
| InChIKey | ZXXXYEWMWYDPCL-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 126.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.30 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|