C16H12O11S — CID 131835076
[2-hydroxy-5-(3,5,7-trihydroxy-6-methoxy-4-oxochromen-2-yl)phenyl] hydrogen sulfate (PubChem CID 131835076) has the molecular formula C16H12O11S and a molecular weight of 412.33 g/mol. Its IUPAC name is [2-hydroxy-5-(3,5,7-trihydroxy-6-methoxy-4-oxochromen-2-yl)phenyl] hydrogen sulfate.
| Compound Name | [2-hydroxy-5-(3,5,7-trihydroxy-6-methoxy-4-oxochromen-2-yl)phenyl] hydrogen sulfate |
|---|---|
| PubChem CID | 131835076 |
| Molecular Formula | C16H12O11S |
| Molecular Weight | 412.33 g/mol |
| Exact Mass | 412.01 |
| IUPAC Name | [2-hydroxy-5-(3,5,7-trihydroxy-6-methoxy-4-oxochromen-2-yl)phenyl] hydrogen sulfate |
| SMILES | COc1c(O)cc2oc(-c3ccc(O)c(OS(=O)(=O)O)c3)c(O)c(=O)c2c1O |
| InChI | InChI=1S/C16H12O11S/c1-25-16-8(18)5-10-11(13(16)20)12(19)14(21)15(26-10)6-2-3-7(17)9(4-6)27-28(22,23)24/h2-5,17-18,20-21H,1H3,(H,22,23,24) |
| InChIKey | MEQVPFQDDJWDBK-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 183.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.33 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|