C17H13IO7 — CID 167110086
3,5-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-7-iodo-6-methoxychromen-4-one (PubChem CID 167110086) has the molecular formula C17H13IO7 and a molecular weight of 456.19 g/mol. Its IUPAC name is 3,5-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-7-iodo-6-methoxychromen-4-one.
| Compound Name | 3,5-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-7-iodo-6-methoxychromen-4-one |
|---|---|
| PubChem CID | 167110086 |
| Molecular Formula | C17H13IO7 |
| Molecular Weight | 456.19 g/mol |
| Exact Mass | 455.97 |
| IUPAC Name | 3,5-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-7-iodo-6-methoxychromen-4-one |
| SMILES | COc1cc(-c2oc3cc(I)c(OC)c(O)c3c(=O)c2O)ccc1O |
| InChI | InChI=1S/C17H13IO7/c1-23-10-5-7(3-4-9(10)19)16-15(22)13(20)12-11(25-16)6-8(18)17(24-2)14(12)21/h3-6,19,21-22H,1-2H3 |
| InChIKey | ORQHMHIGNJPEEC-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 109.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.19 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|