C16H12O9 — CID 178063472
3,5,6,7,8-pentahydroxy-2-(4-hydroxy-3-methoxyphenyl)chromen-4-one (PubChem CID 178063472) has the molecular formula C16H12O9 and a molecular weight of 348.26 g/mol. Its IUPAC name is 3,5,6,7,8-pentahydroxy-2-(4-hydroxy-3-methoxyphenyl)chromen-4-one.
| Compound Name | 3,5,6,7,8-pentahydroxy-2-(4-hydroxy-3-methoxyphenyl)chromen-4-one |
|---|---|
| PubChem CID | 178063472 |
| Molecular Formula | C16H12O9 |
| Molecular Weight | 348.26 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | 3,5,6,7,8-pentahydroxy-2-(4-hydroxy-3-methoxyphenyl)chromen-4-one |
| SMILES | COc1cc(-c2oc3c(O)c(O)c(O)c(O)c3c(=O)c2O)ccc1O |
| InChI | InChI=1S/C16H12O9/c1-24-7-4-5(2-3-6(7)17)15-13(22)10(19)8-9(18)11(20)12(21)14(23)16(8)25-15/h2-4,17-18,20-23H,1H3 |
| InChIKey | KDMWJUYBMJKYOA-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 160.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.26 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|