C18H14O7 — CID 5466137
2-(1,3-benzodioxol-5-yl)-5-hydroxy-3,7-dimethoxychromen-4-one (PubChem CID 5466137) has the molecular formula C18H14O7 and a molecular weight of 342.30 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-5-hydroxy-3,7-dimethoxychromen-4-one.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-5-hydroxy-3,7-dimethoxychromen-4-one |
|---|---|
| PubChem CID | 5466137 |
| Molecular Formula | C18H14O7 |
| Molecular Weight | 342.30 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-5-hydroxy-3,7-dimethoxychromen-4-one |
| SMILES | COc1cc(O)c2c(=O)c(OC)c(-c3ccc4c(c3)OCO4)oc2c1 |
| InChI | InChI=1S/C18H14O7/c1-21-10-6-11(19)15-14(7-10)25-17(18(22-2)16(15)20)9-3-4-12-13(5-9)24-8-23-12/h3-7,19H,8H2,1-2H3 |
| InChIKey | KZBUZACVMLEHTG-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 87.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.30 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |