C26H25NO8 — CID 11634352
2-(3-amino-4-methoxyphenyl)-5-hydroxy-7-methoxy-3-(3,4,5-trimethoxyphenyl)chromen-4-one (PubChem CID 11634352) has the molecular formula C26H25NO8 and a molecular weight of 479.49 g/mol. Its IUPAC name is 2-(3-amino-4-methoxyphenyl)-5-hydroxy-7-methoxy-3-(3,4,5-trimethoxyphenyl)chromen-4-one.
| Compound Name | 2-(3-amino-4-methoxyphenyl)-5-hydroxy-7-methoxy-3-(3,4,5-trimethoxyphenyl)chromen-4-one |
|---|---|
| PubChem CID | 11634352 |
| Molecular Formula | C26H25NO8 |
| Molecular Weight | 479.49 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | 2-(3-amino-4-methoxyphenyl)-5-hydroxy-7-methoxy-3-(3,4,5-trimethoxyphenyl)chromen-4-one |
| SMILES | COc1cc(O)c2c(=O)c(-c3cc(OC)c(OC)c(OC)c3)c(-c3ccc(OC)c(N)c3)oc2c1 |
| InChI | InChI=1S/C26H25NO8/c1-30-15-11-17(28)23-19(12-15)35-25(13-6-7-18(31-2)16(27)8-13)22(24(23)29)14-9-20(32-3)26(34-5)21(10-14)33-4/h6-12,28H,27H2,1-5H3 |
| InChIKey | NXQMJDRPCCYFPU-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 122.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.49 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|