C24H20O6 — CID 163043790
16,17-dimethoxy-21-methylidene-6-prop-1-en-2-yl-2,7,20-trioxapentacyclo[11.8.0.03,11.04,8.014,19]henicosa-1(13),3(11),4(8),9,14,16,18-heptaen-12-one (PubChem CID 163043790) has the molecular formula C24H20O6 and a molecular weight of 404.42 g/mol. Its IUPAC name is 16,17-dimethoxy-21-methylidene-6-prop-1-en-2-yl-2,7,20-trioxapentacyclo[11.8.0.03,11.04,8.014,19]henicosa-1(13),3(11),4(8),9,14,16,18-heptaen-12-one.
| Compound Name | 16,17-dimethoxy-21-methylidene-6-prop-1-en-2-yl-2,7,20-trioxapentacyclo[11.8.0.03,11.04,8.014,19]henicosa-1(13),3(11),4(8),9,14,16,18-heptaen-12-one |
|---|---|
| PubChem CID | 163043790 |
| Molecular Formula | C24H20O6 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | 16,17-dimethoxy-21-methylidene-6-prop-1-en-2-yl-2,7,20-trioxapentacyclo[11.8.0.03,11.04,8.014,19]henicosa-1(13),3(11),4(8),9,14,16,18-heptaen-12-one |
| SMILES | C=C1Oc2cc(OC)c(OC)cc2-c2c1oc1c3c(ccc1c2=O)OC(C(=C)C)C3 |
| InChI | InChI=1S/C24H20O6/c1-11(2)17-9-15-16(29-17)7-6-13-22(25)21-14-8-19(26-4)20(27-5)10-18(14)28-12(3)23(21)30-24(13)15/h6-8,10,17H,1,3,9H2,2,4-5H3 |
| InChIKey | MOQZYKKXGOFEBJ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 67.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|