C20H16O3 — CID 102355326
2-phenyl-8-prop-1-en-2-yl-8,9-dihydrofuro[2,3-h]chromen-4-one (PubChem CID 102355326) has the molecular formula C20H16O3 and a molecular weight of 304.34 g/mol. Its IUPAC name is 2-phenyl-8-prop-1-en-2-yl-8,9-dihydrofuro[2,3-h]chromen-4-one.
| Compound Name | 2-phenyl-8-prop-1-en-2-yl-8,9-dihydrofuro[2,3-h]chromen-4-one |
|---|---|
| PubChem CID | 102355326 |
| Molecular Formula | C20H16O3 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 2-phenyl-8-prop-1-en-2-yl-8,9-dihydrofuro[2,3-h]chromen-4-one |
| SMILES | C=C(C)C1Cc2c(ccc3c(=O)cc(-c4ccccc4)oc23)O1 |
| InChI | InChI=1S/C20H16O3/c1-12(2)18-10-15-17(22-18)9-8-14-16(21)11-19(23-20(14)15)13-6-4-3-5-7-13/h3-9,11,18H,1,10H2,2H3 |
| InChIKey | VWEIGMOLEBQQBN-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|