C21H18O3 — CID 177470234
(8R)-8-[(E)-but-2-en-2-yl]-2-phenyl-8,9-dihydrofuro[2,3-h]chromen-4-one (PubChem CID 177470234) has the molecular formula C21H18O3 and a molecular weight of 318.37 g/mol. Its IUPAC name is (8R)-8-[(E)-but-2-en-2-yl]-2-phenyl-8,9-dihydrofuro[2,3-h]chromen-4-one.
| Compound Name | (8R)-8-[(E)-but-2-en-2-yl]-2-phenyl-8,9-dihydrofuro[2,3-h]chromen-4-one |
|---|---|
| PubChem CID | 177470234 |
| Molecular Formula | C21H18O3 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | (8R)-8-[(E)-but-2-en-2-yl]-2-phenyl-8,9-dihydrofuro[2,3-h]chromen-4-one |
| SMILES | C/C=C(\C)[C@H]1Cc2c(ccc3c(=O)cc(-c4ccccc4)oc23)O1 |
| InChI | InChI=1S/C21H18O3/c1-3-13(2)19-11-16-18(23-19)10-9-15-17(22)12-20(24-21(15)16)14-7-5-4-6-8-14/h3-10,12,19H,11H2,1-2H3/b13-3+/t19-/m1/s1 |
| InChIKey | OXIZAKOUGDXBFD-OWWFXUTMSA-N |
| XLogP | 4.73 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|