C21H16O3 — CID 102355318
(7aR,11aR)-2-phenyl-7a,10,11,11a-tetrahydro-[1]benzofuro[2,3-h]chromen-4-one (PubChem CID 102355318) has the molecular formula C21H16O3 and a molecular weight of 316.36 g/mol. Its IUPAC name is (7aR,11aR)-2-phenyl-7a,10,11,11a-tetrahydro-[1]benzofuro[2,3-h]chromen-4-one.
| Compound Name | (7aR,11aR)-2-phenyl-7a,10,11,11a-tetrahydro-[1]benzofuro[2,3-h]chromen-4-one |
|---|---|
| PubChem CID | 102355318 |
| Molecular Formula | C21H16O3 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | (7aR,11aR)-2-phenyl-7a,10,11,11a-tetrahydro-[1]benzofuro[2,3-h]chromen-4-one |
| SMILES | O=c1cc(-c2ccccc2)oc2c3c(ccc12)O[C@@H]1C=CCC[C@H]31 |
| InChI | InChI=1S/C21H16O3/c22-16-12-19(13-6-2-1-3-7-13)24-21-14(16)10-11-18-20(21)15-8-4-5-9-17(15)23-18/h1-3,5-7,9-12,15,17H,4,8H2/t15-,17+/m0/s1 |
| InChIKey | KHKTYYHFXGRFIV-DOTOQJQBSA-N |
| XLogP | 4.65 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|