C16H14O3 — CID 101332782
(7aS,11aS)-4-methyl-7a,10,11,11a-tetrahydro-[1]benzofuro[2,3-h]chromen-2-one (PubChem CID 101332782) has the molecular formula C16H14O3 and a molecular weight of 254.28 g/mol. Its IUPAC name is (7aS,11aS)-4-methyl-7a,10,11,11a-tetrahydro-[1]benzofuro[2,3-h]chromen-2-one.
| Compound Name | (7aS,11aS)-4-methyl-7a,10,11,11a-tetrahydro-[1]benzofuro[2,3-h]chromen-2-one |
|---|---|
| PubChem CID | 101332782 |
| Molecular Formula | C16H14O3 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | (7aS,11aS)-4-methyl-7a,10,11,11a-tetrahydro-[1]benzofuro[2,3-h]chromen-2-one |
| SMILES | Cc1cc(=O)oc2c3c(ccc12)O[C@H]1C=CCC[C@@H]31 |
| InChI | InChI=1S/C16H14O3/c1-9-8-14(17)19-16-10(9)6-7-13-15(16)11-4-2-3-5-12(11)18-13/h3,5-8,11-12H,2,4H2,1H3/t11-,12+/m1/s1 |
| InChIKey | AKHZQMZHOZHFBH-NEPJUHHUSA-N |
| XLogP | 3.30 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|