C21H16O7 — CID 97488180
(10R)-10-(7-methoxy-1,3-benzodioxol-5-yl)-4-methyl-9,10-dihydropyrano[2,3-f]chromene-2,8-dione (PubChem CID 97488180) has the molecular formula C21H16O7 and a molecular weight of 380.35 g/mol. Its IUPAC name is (10R)-10-(7-methoxy-1,3-benzodioxol-5-yl)-4-methyl-9,10-dihydropyrano[2,3-f]chromene-2,8-dione.
| Compound Name | (10R)-10-(7-methoxy-1,3-benzodioxol-5-yl)-4-methyl-9,10-dihydropyrano[2,3-f]chromene-2,8-dione |
|---|---|
| PubChem CID | 97488180 |
| Molecular Formula | C21H16O7 |
| Molecular Weight | 380.35 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | (10R)-10-(7-methoxy-1,3-benzodioxol-5-yl)-4-methyl-9,10-dihydropyrano[2,3-f]chromene-2,8-dione |
| SMILES | COc1cc([C@H]2CC(=O)Oc3ccc4c(C)cc(=O)oc4c32)cc2c1OCO2 |
| InChI | InChI=1S/C21H16O7/c1-10-5-17(22)28-20-12(10)3-4-14-19(20)13(8-18(23)27-14)11-6-15(24-2)21-16(7-11)25-9-26-21/h3-7,13H,8-9H2,1-2H3/t13-/m1/s1 |
| InChIKey | ALCKQYOVKBRYCI-CYBMUJFWSA-N |
| XLogP | 3.28 |
| TPSA | 84.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.35 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|