C20H16O3 — CID 11044919
(8R)-4-methyl-8-[(E)-2-phenylethenyl]-8,9-dihydrofuro[2,3-h]chromen-2-one (PubChem CID 11044919) has the molecular formula C20H16O3 and a molecular weight of 304.35 g/mol. Its IUPAC name is (8R)-4-methyl-8-[(E)-2-phenylethenyl]-8,9-dihydrofuro[2,3-h]chromen-2-one.
| Compound Name | (8R)-4-methyl-8-[(E)-2-phenylethenyl]-8,9-dihydrofuro[2,3-h]chromen-2-one |
|---|---|
| PubChem CID | 11044919 |
| Molecular Formula | C20H16O3 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | (8R)-4-methyl-8-[(E)-2-phenylethenyl]-8,9-dihydrofuro[2,3-h]chromen-2-one |
| SMILES | Cc1cc(=O)oc2c3c(ccc12)O[C@@H](/C=C/c1ccccc1)C3 |
| InChI | InChI=1S/C20H16O3/c1-13-11-19(21)23-20-16(13)9-10-18-17(20)12-15(22-18)8-7-14-5-3-2-4-6-14/h2-11,15H,12H2,1H3/b8-7+/t15-/m0/s1 |
| InChIKey | DLCOXTWWCCQZTA-KIUWMYQTSA-N |
| XLogP | 4.12 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|