C18H14O4 — CID 11087672
2,6-dimethyl-2-phenyl-[1,3]dioxolo[4,5-h]chromen-8-one (PubChem CID 11087672) has the molecular formula C18H14O4 and a molecular weight of 294.31 g/mol. Its IUPAC name is 2,6-dimethyl-2-phenyl-[1,3]dioxolo[4,5-h]chromen-8-one.
| Compound Name | 2,6-dimethyl-2-phenyl-[1,3]dioxolo[4,5-h]chromen-8-one |
|---|---|
| PubChem CID | 11087672 |
| Molecular Formula | C18H14O4 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 2,6-dimethyl-2-phenyl-[1,3]dioxolo[4,5-h]chromen-8-one |
| SMILES | Cc1cc(=O)oc2c3c(ccc12)OC(C)(c1ccccc1)O3 |
| InChI | InChI=1S/C18H14O4/c1-11-10-15(19)20-16-13(11)8-9-14-17(16)22-18(2,21-14)12-6-4-3-5-7-12/h3-10H,1-2H3 |
| InChIKey | YMGZORLESXHPRU-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|