C25H21NO4 — CID 10620941
4-methoxy-7-methyl-2,3-diphenyl-2,3-dihydropyrano[3,2-h][1,4]benzoxazin-9-one (PubChem CID 10620941) has the molecular formula C25H21NO4 and a molecular weight of 399.45 g/mol. Its IUPAC name is 4-methoxy-7-methyl-2,3-diphenyl-2,3-dihydropyrano[3,2-h][1,4]benzoxazin-9-one.
| Compound Name | 4-methoxy-7-methyl-2,3-diphenyl-2,3-dihydropyrano[3,2-h][1,4]benzoxazin-9-one |
|---|---|
| PubChem CID | 10620941 |
| Molecular Formula | C25H21NO4 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | 4-methoxy-7-methyl-2,3-diphenyl-2,3-dihydropyrano[3,2-h][1,4]benzoxazin-9-one |
| SMILES | CON1c2ccc3c(C)cc(=O)oc3c2OC(c2ccccc2)C1c1ccccc1 |
| InChI | InChI=1S/C25H21NO4/c1-16-15-21(27)29-24-19(16)13-14-20-25(24)30-23(18-11-7-4-8-12-18)22(26(20)28-2)17-9-5-3-6-10-17/h3-15,22-23H,1-2H3 |
| InChIKey | NEYQVSULZYBUBY-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|